C21H30N5O2+ — CID 143565701
[(Z)-2-[[(2E)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]propyl]-methylamino]ethenyl]-methylazanium (PubChem CID 143565701) has the molecular formula C21H30N5O2+ and a molecular weight of 384.50 g/mol. Its IUPAC name is [(Z)-2-[[(2E)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]propyl]-methylamino]ethenyl]-methylazanium.
| Compound Name | [(Z)-2-[[(2E)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]propyl]-methylamino]ethenyl]-methylazanium |
|---|---|
| PubChem CID | 143565701 |
| Molecular Formula | C21H30N5O2+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [(Z)-2-[[(2E)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]propyl]-methylamino]ethenyl]-methylazanium |
| SMILES | C[NH2+]/C=C\N(C)C/C(C)=N/N(C)c1ccc(NCc2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-16(15-25(3)12-11-22-2)24-26(4)19-8-6-18(7-9-19)23-14-17-5-10-20(27)13-21(17)28/h5-13,22-23,27-28H,14-15H2,1-4H3/p+1/b12-11-,24-16+ |
| InChIKey | IBLWAHXWZAXKKX-CIWMCXQZSA-O |
| XLogP | 2.12 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|