C22H28N4 — CID 143569041
1-N-benzyl-4-N-methyl-4-N-[(E)-[(4Z,6Z)-7-(methylamino)hepta-4,6-dien-2-ylidene]amino]benzene-1,4-diamine (PubChem CID 143569041) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-N-benzyl-4-N-methyl-4-N-[(E)-[(4Z,6Z)-7-(methylamino)hepta-4,6-dien-2-ylidene]amino]benzene-1,4-diamine.
| Compound Name | 1-N-benzyl-4-N-methyl-4-N-[(E)-[(4Z,6Z)-7-(methylamino)hepta-4,6-dien-2-ylidene]amino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143569041 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-N-benzyl-4-N-methyl-4-N-[(E)-[(4Z,6Z)-7-(methylamino)hepta-4,6-dien-2-ylidene]amino]benzene-1,4-diamine |
| SMILES | CN/C=C\C=C/C/C(C)=N/N(C)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4/c1-19(10-6-5-9-17-23-2)25-26(3)22-15-13-21(14-16-22)24-18-20-11-7-4-8-12-20/h4-9,11-17,23-24H,10,18H2,1-3H3/b6-5-,17-9-,25-19+ |
| InChIKey | IKQUKCILBVXDIQ-SDUMKFEGSA-N |
| XLogP | 4.79 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|