C24H29N5 — CID 143565750
2-N-[(2E)-2-[(4-anilinophenyl)-methylhydrazinylidene]propyl]-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 143565750) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-N-[(2E)-2-[(4-anilinophenyl)-methylhydrazinylidene]propyl]-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N-[(2E)-2-[(4-anilinophenyl)-methylhydrazinylidene]propyl]-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 143565750 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-N-[(2E)-2-[(4-anilinophenyl)-methylhydrazinylidene]propyl]-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CNc1ccccc1N(C)C/C(C)=N/N(C)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N5/c1-19(18-28(3)24-13-9-8-12-23(24)25-2)27-29(4)22-16-14-21(15-17-22)26-20-10-6-5-7-11-20/h5-17,25-26H,18H2,1-4H3/b27-19+ |
| InChIKey | XVHKUYKSBSARRR-ZXVVBBHZSA-N |
| XLogP | 5.42 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|