C20H32N5O2+ — CID 143565726
[(Z)-2-[[(2Z)-3-ethoxy-2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-3-oxopropyl]-methylamino]ethenyl]-methylazanium (PubChem CID 143565726) has the molecular formula C20H32N5O2+ and a molecular weight of 374.51 g/mol. Its IUPAC name is [(Z)-2-[[(2Z)-3-ethoxy-2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-3-oxopropyl]-methylamino]ethenyl]-methylazanium.
| Compound Name | [(Z)-2-[[(2Z)-3-ethoxy-2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-3-oxopropyl]-methylamino]ethenyl]-methylazanium |
|---|---|
| PubChem CID | 143565726 |
| Molecular Formula | C20H32N5O2+ |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [(Z)-2-[[(2Z)-3-ethoxy-2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-3-oxopropyl]-methylamino]ethenyl]-methylazanium |
| SMILES | CCOC(=O)/C(CN(C)/C=C\[NH2+]C)=N\N(C)c1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C20H31N5O2/c1-6-27-20(26)18(15-23(3)13-11-21-2)22-25(5)17-9-10-19-16(14-17)8-7-12-24(19)4/h9-11,13-14,21H,6-8,12,15H2,1-5H3/p+1/b13-11-,22-18- |
| InChIKey | UVIDGUVEDNYLPB-SGJAMGDOSA-O |
| XLogP | 1.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|