C18H27N4+ — CID 143569120
[(E)-C-methyl-N-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]carbonimidoyl]-[(1E,3Z)-penta-1,3-dienyl]azanium (PubChem CID 143569120) has the molecular formula C18H27N4+ and a molecular weight of 299.44 g/mol. Its IUPAC name is [(E)-C-methyl-N-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]carbonimidoyl]-[(1E,3Z)-penta-1,3-dienyl]azanium.
| Compound Name | [(E)-C-methyl-N-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]carbonimidoyl]-[(1E,3Z)-penta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 143569120 |
| Molecular Formula | C18H27N4+ |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | [(E)-C-methyl-N-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]carbonimidoyl]-[(1E,3Z)-penta-1,3-dienyl]azanium |
| SMILES | C/C=C\C=C\[NH2+]/C(C)=N/N(C)c1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C18H26N4/c1-5-6-7-12-19-15(2)20-22(4)17-10-11-18-16(14-17)9-8-13-21(18)3/h5-7,10-12,14H,8-9,13H2,1-4H3,(H,19,20)/p+1/b6-5-,12-7+ |
| InChIKey | WCRHILDIJDLMGX-UNKATYBDSA-O |
| XLogP | 2.49 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|