About 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine
2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine (PubChem CID 79329028) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine |
| PubChem CID | 79329028 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine |
| SMILES | CC(=Cc1ccc2c(c1)CCCN2C)CN |
| InChI | InChI=1S/C14H20N2/c1-11(10-15)8-12-5-6-14-13(9-12)4-3-7-16(14)2/h5-6,8-9H,3-4,7,10,15H2,1-2H3 |
| InChIKey | KJAOBSVGEQBYNH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine?
The IUPAC name of 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine (CID 79329028) is 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine.
What is the SMILES notation for 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine?
The canonical SMILES for 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine is CC(=Cc1ccc2c(c1)CCCN2C)CN.
What is the InChIKey of 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine?
The InChIKey is KJAOBSVGEQBYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-11(10-15)8-12-5-6-14-13(9-12)4-3-7-16(14)2/h5-6,8-9H,3-4,7,10,15H2,1-2H3.
What are the key properties of 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine?
2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine has a molecular weight of 216.33 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)prop-2-en-1-amine is sourced from PubChem (CID 79329028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).