C18H21N3 — CID 145091248
N-[(1E,3Z)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)penta-1,3-dienyl]ethanimidoyl cyanide (PubChem CID 145091248) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-[(1E,3Z)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)penta-1,3-dienyl]ethanimidoyl cyanide.
| Compound Name | N-[(1E,3Z)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)penta-1,3-dienyl]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 145091248 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[(1E,3Z)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)penta-1,3-dienyl]ethanimidoyl cyanide |
| SMILES | C/C=C\C(=C/N=C(\C)C#N)c1ccc2c(c1)CCCN2C |
| InChI | InChI=1S/C18H21N3/c1-4-6-17(13-20-14(2)12-19)15-8-9-18-16(11-15)7-5-10-21(18)3/h4,6,8-9,11,13H,5,7,10H2,1-3H3/b6-4-,17-13+,20-14+ |
| InChIKey | ZMEDWYLUICXCOG-PCOFKJHMSA-N |
| XLogP | 3.97 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|