C20H25N4O2+ — CID 76699729
methyl 2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-2-(1-methylpyridin-1-ium-2-yl)acetate (PubChem CID 76699729) has the molecular formula C20H25N4O2+ and a molecular weight of 353.45 g/mol. Its IUPAC name is methyl 2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-2-(1-methylpyridin-1-ium-2-yl)acetate.
| Compound Name | methyl 2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-2-(1-methylpyridin-1-ium-2-yl)acetate |
|---|---|
| PubChem CID | 76699729 |
| Molecular Formula | C20H25N4O2+ |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | methyl 2-[methyl-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)hydrazinylidene]-2-(1-methylpyridin-1-ium-2-yl)acetate |
| SMILES | COC(=O)C(=NN(C)c1ccc2c(c1)CCCN2C)c1cccc[n+]1C |
| InChI | InChI=1S/C20H25N4O2/c1-22-13-7-8-15-14-16(10-11-17(15)22)24(3)21-19(20(25)26-4)18-9-5-6-12-23(18)2/h5-6,9-12,14H,7-8,13H2,1-4H3/q+1 |
| InChIKey | ZPOUBYNBQVFOHA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|