C28H45N6O2+ — CID 143565674
[(E)-N-[4-[4-(diethylamino)anilino]-N-methylanilino]-C-ethoxycarbonylcarbonimidoyl]-[(Z)-2-(dimethylamino)ethenyl]-methylazanium;ethane (PubChem CID 143565674) has the molecular formula C28H45N6O2+ and a molecular weight of 497.71 g/mol. Its IUPAC name is [(E)-N-[4-[4-(diethylamino)anilino]-N-methylanilino]-C-ethoxycarbonylcarbonimidoyl]-[(Z)-2-(dimethylamino)ethenyl]-methylazanium;ethane.
| Compound Name | [(E)-N-[4-[4-(diethylamino)anilino]-N-methylanilino]-C-ethoxycarbonylcarbonimidoyl]-[(Z)-2-(dimethylamino)ethenyl]-methylazanium;ethane |
|---|---|
| PubChem CID | 143565674 |
| Molecular Formula | C28H45N6O2+ |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | [(E)-N-[4-[4-(diethylamino)anilino]-N-methylanilino]-C-ethoxycarbonylcarbonimidoyl]-[(Z)-2-(dimethylamino)ethenyl]-methylazanium;ethane |
| SMILES | CC.CCOC(=O)/C(=N\N(C)c1ccc(Nc2ccc(N(CC)CC)cc2)cc1)[NH+](C)/C=C\N(C)C |
| InChI | InChI=1S/C26H38N6O2.C2H6/c1-8-32(9-2)24-17-13-22(14-18-24)27-21-11-15-23(16-12-21)31(7)28-25(26(33)34-10-3)30(6)20-19-29(4)5;1-2/h11-20,27H,8-10H2,1-7H3;1-2H3/p+1/b20-19-,28-25+; |
| InChIKey | CJICSNMVXZTJRD-JIGDJUGMSA-O |
| XLogP | 4.16 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|