C21H37NO — CID 148996587
N-[(E)-4-methoxy-3-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]octan-1-amine (PubChem CID 148996587) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is N-[(E)-4-methoxy-3-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]octan-1-amine.
| Compound Name | N-[(E)-4-methoxy-3-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]octan-1-amine |
|---|---|
| PubChem CID | 148996587 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | N-[(E)-4-methoxy-3-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]octan-1-amine |
| SMILES | CCCCCCCCNC(C)/C(C)=C(/OC)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C21H37NO/c1-6-7-8-9-10-11-16-22-19(4)18(3)21(23-5)20-14-12-17(2)13-15-20/h12,14,19,22H,6-11,13,15-16H2,1-5H3/b21-18+ |
| InChIKey | PYUNQZIPLXJWMX-DYTRJAOYSA-N |
| XLogP | 5.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|