C21H33BrNO5P — CID 149001589
(2R)-5-(4-bromophenyl)-N-(2-diethoxyphosphorylethyl)-2-(2-methylpropyl)-4-oxopentanamide (PubChem CID 149001589) has the molecular formula C21H33BrNO5P and a molecular weight of 490.38 g/mol. Its IUPAC name is (2R)-5-(4-bromophenyl)-N-(2-diethoxyphosphorylethyl)-2-(2-methylpropyl)-4-oxopentanamide.
| Compound Name | (2R)-5-(4-bromophenyl)-N-(2-diethoxyphosphorylethyl)-2-(2-methylpropyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 149001589 |
| Molecular Formula | C21H33BrNO5P |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (2R)-5-(4-bromophenyl)-N-(2-diethoxyphosphorylethyl)-2-(2-methylpropyl)-4-oxopentanamide |
| SMILES | CCOP(=O)(CCNC(=O)[C@@H](CC(=O)Cc1ccc(Br)cc1)CC(C)C)OCC |
| InChI | InChI=1S/C21H33BrNO5P/c1-5-27-29(26,28-6-2)12-11-23-21(25)18(13-16(3)4)15-20(24)14-17-7-9-19(22)10-8-17/h7-10,16,18H,5-6,11-15H2,1-4H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | PZTKOQQOKVRAJV-GOSISDBHSA-N |
| XLogP | 5.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|