C10H18O2 — CID 14901528
(3E,5S)-5-hydroperoxydeca-1,3-diene (PubChem CID 14901528) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3E,5S)-5-hydroperoxydeca-1,3-diene.
| Compound Name | (3E,5S)-5-hydroperoxydeca-1,3-diene |
|---|---|
| PubChem CID | 14901528 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3E,5S)-5-hydroperoxydeca-1,3-diene |
| SMILES | C=C/C=C/[C@H](CCCCC)OO |
| InChI | InChI=1S/C10H18O2/c1-3-5-7-9-10(12-11)8-6-4-2/h4,6,8,10-11H,2-3,5,7,9H2,1H3/b8-6+/t10-/m1/s1 |
| InChIKey | VPGPLTUFZUFXBX-QEHWCHDUSA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|