C6H9N7 — CID 149017523
7-N,7-N-diaminopyrrolo[2,3-d]pyrimidine-4,7-diamine (PubChem CID 149017523) has the molecular formula C6H9N7 and a molecular weight of 179.19 g/mol. Its IUPAC name is 7-N,7-N-diaminopyrrolo[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 7-N,7-N-diaminopyrrolo[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 149017523 |
| Molecular Formula | C6H9N7 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 7-N,7-N-diaminopyrrolo[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1ncnc2c1ccn2N(N)N |
| InChI | InChI=1S/C6H9N7/c7-5-4-1-2-12(13(8)9)6(4)11-3-10-5/h1-3H,8-9H2,(H2,7,10,11) |
| InChIKey | QCVIJINQIXYYMS-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|