C9H14O5 — CID 149018534
2-(hydroxymethyl)-4-prop-2-ynoxyoxane-3,5-diol (PubChem CID 149018534) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-prop-2-ynoxyoxane-3,5-diol.
| Compound Name | 2-(hydroxymethyl)-4-prop-2-ynoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 149018534 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(hydroxymethyl)-4-prop-2-ynoxyoxane-3,5-diol |
| SMILES | C#CCOC1C(O)COC(CO)C1O |
| InChI | InChI=1S/C9H14O5/c1-2-3-13-9-6(11)5-14-7(4-10)8(9)12/h1,6-12H,3-5H2 |
| InChIKey | QDABECBHXWILKB-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|