C24H21N3O3S — CID 149019947
4-methyl-3-(naphthalen-2-ylsulfonylamino)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 149019947) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 4-methyl-3-(naphthalen-2-ylsulfonylamino)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-methyl-3-(naphthalen-2-ylsulfonylamino)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 149019947 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-methyl-3-(naphthalen-2-ylsulfonylamino)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccnc2)cc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H21N3O3S/c1-17-8-9-21(24(28)26-16-18-5-4-12-25-15-18)14-23(17)27-31(29,30)22-11-10-19-6-2-3-7-20(19)13-22/h2-15,27H,16H2,1H3,(H,26,28) |
| InChIKey | QDGQWQPXMRYQTC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |