C25H25NO4 — CID 14902974
(E,2R,3R)-3-(4-methoxyanilino)-4-methyl-2-phenoxy-5-phenylpent-4-enoic acid (PubChem CID 14902974) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E,2R,3R)-3-(4-methoxyanilino)-4-methyl-2-phenoxy-5-phenylpent-4-enoic acid.
| Compound Name | (E,2R,3R)-3-(4-methoxyanilino)-4-methyl-2-phenoxy-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 14902974 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E,2R,3R)-3-(4-methoxyanilino)-4-methyl-2-phenoxy-5-phenylpent-4-enoic acid |
| SMILES | COc1ccc(N[C@H](/C(C)=C/c2ccccc2)[C@@H](Oc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H25NO4/c1-18(17-19-9-5-3-6-10-19)23(26-20-13-15-21(29-2)16-14-20)24(25(27)28)30-22-11-7-4-8-12-22/h3-17,23-24,26H,1-2H3,(H,27,28)/b18-17+/t23-,24-/m1/s1 |
| InChIKey | HNHSVVASRJETLY-BEZSILKHSA-N |
| XLogP | 5.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|