C17H13N5O — CID 149032687
3-[2-(8-amino-1,7-naphthyridin-5-yl)ethynyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 149032687) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 3-[2-(8-amino-1,7-naphthyridin-5-yl)ethynyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[2-(8-amino-1,7-naphthyridin-5-yl)ethynyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 149032687 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-[2-(8-amino-1,7-naphthyridin-5-yl)ethynyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cccc(C#Cc2cnc(N)c3ncccc23)c1 |
| InChI | InChI=1S/C17H13N5O/c18-16(22-23)12-4-1-3-11(9-12)6-7-13-10-21-17(19)15-14(13)5-2-8-20-15/h1-5,8-10,23H,(H2,18,22)(H2,19,21) |
| InChIKey | QFYBXXSARLVALX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|