C23H18N6O — CID 134276672
3-[2-[1-amino-6-(5-methylpyrazin-2-yl)isoquinolin-4-yl]ethynyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 134276672) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is 3-[2-[1-amino-6-(5-methylpyrazin-2-yl)isoquinolin-4-yl]ethynyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[2-[1-amino-6-(5-methylpyrazin-2-yl)isoquinolin-4-yl]ethynyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 134276672 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-[2-[1-amino-6-(5-methylpyrazin-2-yl)isoquinolin-4-yl]ethynyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1cnc(-c2ccc3c(N)ncc(C#Cc4cccc(/C(N)=N/O)c4)c3c2)cn1 |
| InChI | InChI=1S/C23H18N6O/c1-14-11-27-21(13-26-14)16-7-8-19-20(10-16)18(12-28-23(19)25)6-5-15-3-2-4-17(9-15)22(24)29-30/h2-4,7-13,30H,1H3,(H2,24,29)(H2,25,28) |
| InChIKey | ATQHYVZXENYDCF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|