C19H15N3 — CID 58455780
5-(4-methylphenyl)-3-(2-phenylethynyl)pyrazin-2-amine (PubChem CID 58455780) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-(2-phenylethynyl)pyrazin-2-amine.
| Compound Name | 5-(4-methylphenyl)-3-(2-phenylethynyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 58455780 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-(4-methylphenyl)-3-(2-phenylethynyl)pyrazin-2-amine |
| SMILES | Cc1ccc(-c2cnc(N)c(C#Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N3/c1-14-7-10-16(11-8-14)18-13-21-19(20)17(22-18)12-9-15-5-3-2-4-6-15/h2-8,10-11,13H,1H3,(H2,20,21) |
| InChIKey | SWZSMGRSDOQWKW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|