C23H24N2O2S — CID 157207435
2-methyl-3-[2-(3-methylphenyl)ethynyl]-5-(4-propan-2-ylsulfonylphenyl)pyrazine;molecular hydrogen (PubChem CID 157207435) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-methyl-3-[2-(3-methylphenyl)ethynyl]-5-(4-propan-2-ylsulfonylphenyl)pyrazine;molecular hydrogen.
| Compound Name | 2-methyl-3-[2-(3-methylphenyl)ethynyl]-5-(4-propan-2-ylsulfonylphenyl)pyrazine;molecular hydrogen |
|---|---|
| PubChem CID | 157207435 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-methyl-3-[2-(3-methylphenyl)ethynyl]-5-(4-propan-2-ylsulfonylphenyl)pyrazine;molecular hydrogen |
| SMILES | Cc1cccc(C#Cc2nc(-c3ccc(S(=O)(=O)C(C)C)cc3)cnc2C)c1.[H][H] |
| InChI | InChI=1S/C23H22N2O2S.H2/c1-16(2)28(26,27)21-11-9-20(10-12-21)23-15-24-18(4)22(25-23)13-8-19-7-5-6-17(3)14-19;/h5-7,9-12,14-16H,1-4H3;1H |
| InChIKey | ARMZKEAUUICXSY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|