C19H16F3N3O2S — CID 174872147
2-(4-propan-2-ylsulfonylphenyl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine (PubChem CID 174872147) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-(4-propan-2-ylsulfonylphenyl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine.
| Compound Name | 2-(4-propan-2-ylsulfonylphenyl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine |
|---|---|
| PubChem CID | 174872147 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-(4-propan-2-ylsulfonylphenyl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cncc(-c3ccc(C(F)(F)F)nc3)n2)cc1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-12(2)28(26,27)15-6-3-13(4-7-15)16-10-23-11-17(25-16)14-5-8-18(24-9-14)19(20,21)22/h3-12H,1-2H3 |
| InChIKey | VCAHBISGIBIWOC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |