C20H18F3N5 — CID 177153206
2-(4-phenylpiperazin-1-yl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine (PubChem CID 177153206) has the molecular formula C20H18F3N5 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-yl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine.
| Compound Name | 2-(4-phenylpiperazin-1-yl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine |
|---|---|
| PubChem CID | 177153206 |
| Molecular Formula | C20H18F3N5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-(4-phenylpiperazin-1-yl)-6-[6-(trifluoromethyl)-3-pyridinyl]pyrazine |
| SMILES | FC(F)(F)c1ccc(-c2cncc(N3CCN(c4ccccc4)CC3)n2)cn1 |
| InChI | InChI=1S/C20H18F3N5/c21-20(22,23)18-7-6-15(12-25-18)17-13-24-14-19(26-17)28-10-8-27(9-11-28)16-4-2-1-3-5-16/h1-7,12-14H,8-11H2 |
| InChIKey | CYKDEUXQBBTAAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |