C17H15NO3 — CID 14903548
2-[(4-nitrophenyl)methyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 14903548) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-[(4-nitrophenyl)methyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 14903548 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NO3/c19-17-14(8-7-13-3-1-2-4-16(13)17)11-12-5-9-15(10-6-12)18(20)21/h1-6,9-10,14H,7-8,11H2 |
| InChIKey | WGJPIIVKXUVGJL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|