C19H20N2O2 — CID 149037989
2-[(4-butylphenoxy)methyl]-3H-1,7-naphthyridin-4-one (PubChem CID 149037989) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(4-butylphenoxy)methyl]-3H-1,7-naphthyridin-4-one.
| Compound Name | 2-[(4-butylphenoxy)methyl]-3H-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 149037989 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[(4-butylphenoxy)methyl]-3H-1,7-naphthyridin-4-one |
| SMILES | CCCCc1ccc(OCC2=Nc3cnccc3C(=O)C2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-3-4-14-5-7-16(8-6-14)23-13-15-11-19(22)17-9-10-20-12-18(17)21-15/h5-10,12H,2-4,11,13H2,1H3 |
| InChIKey | QGZRMKYCFMIRCC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |