C15H11FN2O2 — CID 159425716
2-[(4-fluorophenoxy)methyl]-3H-1,7-naphthyridin-4-one (PubChem CID 159425716) has the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-3H-1,7-naphthyridin-4-one.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-3H-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 159425716 |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-3H-1,7-naphthyridin-4-one |
| SMILES | O=C1CC(COc2ccc(F)cc2)=Nc2cnccc21 |
| InChI | InChI=1S/C15H11FN2O2/c16-10-1-3-12(4-2-10)20-9-11-7-15(19)13-5-6-17-8-14(13)18-11/h1-6,8H,7,9H2 |
| InChIKey | LQIABMRGHUYHOP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |