C20H15N3O2 — CID 159615706
2-[(2-pyridin-4-ylphenoxy)methyl]-3H-1,7-naphthyridin-4-one (PubChem CID 159615706) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[(2-pyridin-4-ylphenoxy)methyl]-3H-1,7-naphthyridin-4-one.
| Compound Name | 2-[(2-pyridin-4-ylphenoxy)methyl]-3H-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 159615706 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[(2-pyridin-4-ylphenoxy)methyl]-3H-1,7-naphthyridin-4-one |
| SMILES | O=C1CC(COc2ccccc2-c2ccncc2)=Nc2cnccc21 |
| InChI | InChI=1S/C20H15N3O2/c24-19-11-15(23-18-12-22-10-7-17(18)19)13-25-20-4-2-1-3-16(20)14-5-8-21-9-6-14/h1-10,12H,11,13H2 |
| InChIKey | MNGHBKUOASPUDR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |