C23H23FN2O3 — CID 32645882
N-[4-(4-fluorophenoxy)butyl]-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 32645882) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 32645882 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H23FN2O3/c24-20-7-11-21(12-8-20)28-15-2-1-14-26-23(27)19-5-9-22(10-6-19)29-17-18-4-3-13-25-16-18/h3-13,16H,1-2,14-15,17H2,(H,26,27) |
| InChIKey | GNAIXDYCCCKVOT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|