C20H24N2O4 — CID 30853271
methyl 6-[[4-(pyridin-3-ylmethoxy)benzoyl]amino]hexanoate (PubChem CID 30853271) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 6-[[4-(pyridin-3-ylmethoxy)benzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-(pyridin-3-ylmethoxy)benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 30853271 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 6-[[4-(pyridin-3-ylmethoxy)benzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-25-19(23)7-3-2-4-13-22-20(24)17-8-10-18(11-9-17)26-15-16-6-5-12-21-14-16/h5-6,8-12,14H,2-4,7,13,15H2,1H3,(H,22,24) |
| InChIKey | MYLTZVWOWRNEGW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|