C21H20FN3O3 — CID 76877849
N'-[2-(4-fluorophenoxy)ethoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide (PubChem CID 76877849) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)ethoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-[2-(4-fluorophenoxy)ethoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 76877849 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)ethoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide |
| SMILES | NC(=NOCCOc1ccc(F)cc1)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20FN3O3/c22-18-5-9-19(10-6-18)26-12-13-28-25-21(23)17-3-7-20(8-4-17)27-15-16-2-1-11-24-14-16/h1-11,14H,12-13,15H2,(H2,23,25) |
| InChIKey | LOQFYJMFZBEVQH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|