C20H17BrClN3O2 — CID 155968174
N'-[(3-bromo-2-chlorophenyl)methoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide (PubChem CID 155968174) has the molecular formula C20H17BrClN3O2 and a molecular weight of 446.73 g/mol. Its IUPAC name is N'-[(3-bromo-2-chlorophenyl)methoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide.
| Compound Name | N'-[(3-bromo-2-chlorophenyl)methoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 155968174 |
| Molecular Formula | C20H17BrClN3O2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N'-[(3-bromo-2-chlorophenyl)methoxy]-4-(pyridin-3-ylmethoxy)benzenecarboximidamide |
| SMILES | N/C(=N\OCc1cccc(Br)c1Cl)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H17BrClN3O2/c21-18-5-1-4-16(19(18)22)13-27-25-20(23)15-6-8-17(9-7-15)26-12-14-3-2-10-24-11-14/h1-11H,12-13H2,(H2,23,25) |
| InChIKey | YIDJVULYIMWJJC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|