C9H15N3O2 — CID 149041190
2-N,6-N-dimethyl-1,2,3,6-tetrahydropyridine-2,6-dicarboxamide (PubChem CID 149041190) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-1,2,3,6-tetrahydropyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-dimethyl-1,2,3,6-tetrahydropyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 149041190 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-N,6-N-dimethyl-1,2,3,6-tetrahydropyridine-2,6-dicarboxamide |
| SMILES | CNC(=O)C1C=CCC(C(=O)NC)N1 |
| InChI | InChI=1S/C9H15N3O2/c1-10-8(13)6-4-3-5-7(12-6)9(14)11-2/h3-4,6-7,12H,5H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | QHPQCILBISYLBE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|