C24H19N3O3 — CID 149046872
6-[2-methyl-6-(2-methylphenoxy)indazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 149046872) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 6-[2-methyl-6-(2-methylphenoxy)indazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 6-[2-methyl-6-(2-methylphenoxy)indazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 149046872 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 6-[2-methyl-6-(2-methylphenoxy)indazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | Cc1ccccc1Oc1ccc2c(C3=Cc4nccc(C(=O)O)c4C3)n(C)nc2c1 |
| InChI | InChI=1S/C24H19N3O3/c1-14-5-3-4-6-22(14)30-16-7-8-18-21(13-16)26-27(2)23(18)15-11-19-17(24(28)29)9-10-25-20(19)12-15/h3-10,12-13H,11H2,1-2H3,(H,28,29) |
| InChIKey | QIWCYBPUWWBCFA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |