C23H17N3O2S — CID 160920337
6-(1-methyl-6-phenylsulfanylindazol-3-yl)-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 160920337) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 6-(1-methyl-6-phenylsulfanylindazol-3-yl)-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 6-(1-methyl-6-phenylsulfanylindazol-3-yl)-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 160920337 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 6-(1-methyl-6-phenylsulfanylindazol-3-yl)-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | Cn1nc(C2=Cc3nccc(C(=O)O)c3C2)c2ccc(Sc3ccccc3)cc21 |
| InChI | InChI=1S/C23H17N3O2S/c1-26-21-13-16(29-15-5-3-2-4-6-15)7-8-18(21)22(25-26)14-11-19-17(23(27)28)9-10-24-20(19)12-14/h2-10,12-13H,11H2,1H3,(H,27,28) |
| InChIKey | SRYDJQMHCGQWDD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |