C11H11NO2 — CID 160512753
6-ethyl-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 160512753) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-ethyl-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 6-ethyl-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 160512753 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-ethyl-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | CCC1=Cc2nccc(C(=O)O)c2C1 |
| InChI | InChI=1S/C11H11NO2/c1-2-7-5-9-8(11(13)14)3-4-12-10(9)6-7/h3-4,6H,2,5H2,1H3,(H,13,14) |
| InChIKey | AHRPVEKZJFHRQW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |