C19H15ClN2O — CID 157444487
1-[6-[(4-chloro-3-methylphenyl)methyl]-5H-cyclopenta[b]pyridin-4-yl]-2-isocyanoethanone (PubChem CID 157444487) has the molecular formula C19H15ClN2O and a molecular weight of 322.80 g/mol. Its IUPAC name is 1-[6-[(4-chloro-3-methylphenyl)methyl]-5H-cyclopenta[b]pyridin-4-yl]-2-isocyanoethanone.
| Compound Name | 1-[6-[(4-chloro-3-methylphenyl)methyl]-5H-cyclopenta[b]pyridin-4-yl]-2-isocyanoethanone |
|---|---|
| PubChem CID | 157444487 |
| Molecular Formula | C19H15ClN2O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[6-[(4-chloro-3-methylphenyl)methyl]-5H-cyclopenta[b]pyridin-4-yl]-2-isocyanoethanone |
| SMILES | [C-]#[N+]CC(=O)c1ccnc2c1CC(Cc1ccc(Cl)c(C)c1)=C2 |
| InChI | InChI=1S/C19H15ClN2O/c1-12-7-13(3-4-17(12)20)8-14-9-16-15(19(23)11-21-2)5-6-22-18(16)10-14/h3-7,10H,8-9,11H2,1H3 |
| InChIKey | FORQMHCBWHAIJO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|