C17H15NO3 — CID 146858339
6-[(3-methoxyphenyl)methyl]-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 146858339) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methyl]-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 6-[(3-methoxyphenyl)methyl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 146858339 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-[(3-methoxyphenyl)methyl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | COc1cccc(CC2=Cc3nccc(C(=O)O)c3C2)c1 |
| InChI | InChI=1S/C17H15NO3/c1-21-13-4-2-3-11(8-13)7-12-9-15-14(17(19)20)5-6-18-16(15)10-12/h2-6,8,10H,7,9H2,1H3,(H,19,20) |
| InChIKey | SKAWJTPVHNEDFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |