C10H9NO2 — CID 160512752
7-methyl-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 160512752) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 7-methyl-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 7-methyl-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 160512752 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 7-methyl-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | CC1=CCc2c(C(=O)O)ccnc21 |
| InChI | InChI=1S/C10H9NO2/c1-6-2-3-7-8(10(12)13)4-5-11-9(6)7/h2,4-5H,3H2,1H3,(H,12,13) |
| InChIKey | CRDFFPHFSRZWBK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |