C17H19FN4O2 — CID 149056174
4-(5-fluoro-6-morpholin-4-yl-1,3-dihydroisoindol-2-yl)-5-methyl-1H-pyridazin-6-one (PubChem CID 149056174) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 4-(5-fluoro-6-morpholin-4-yl-1,3-dihydroisoindol-2-yl)-5-methyl-1H-pyridazin-6-one.
| Compound Name | 4-(5-fluoro-6-morpholin-4-yl-1,3-dihydroisoindol-2-yl)-5-methyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 149056174 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-(5-fluoro-6-morpholin-4-yl-1,3-dihydroisoindol-2-yl)-5-methyl-1H-pyridazin-6-one |
| SMILES | Cc1c(N2Cc3cc(F)c(N4CCOCC4)cc3C2)cn[nH]c1=O |
| InChI | InChI=1S/C17H19FN4O2/c1-11-16(8-19-20-17(11)23)22-9-12-6-14(18)15(7-13(12)10-22)21-2-4-24-5-3-21/h6-8H,2-5,9-10H2,1H3,(H,20,23) |
| InChIKey | QKWLHOLFDFHXJI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|