C10H16N2O — CID 149059534
1-(2-methyl-2,7-diazabicyclo[4.2.0]octan-7-yl)prop-2-en-1-one (PubChem CID 149059534) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(2-methyl-2,7-diazabicyclo[4.2.0]octan-7-yl)prop-2-en-1-one.
| Compound Name | 1-(2-methyl-2,7-diazabicyclo[4.2.0]octan-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 149059534 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(2-methyl-2,7-diazabicyclo[4.2.0]octan-7-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2C1CCCN2C |
| InChI | InChI=1S/C10H16N2O/c1-3-10(13)12-7-9-8(12)5-4-6-11(9)2/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | QLMNNPLTDANFKJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|