C13H8F6N6 — CID 1490716
5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1-[3-(trifluoromethyl)phenyl]tetrazole (PubChem CID 1490716) has the molecular formula C13H8F6N6 and a molecular weight of 362.24 g/mol. Its IUPAC name is 5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1-[3-(trifluoromethyl)phenyl]tetrazole.
| Compound Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1-[3-(trifluoromethyl)phenyl]tetrazole |
|---|---|
| PubChem CID | 1490716 |
| Molecular Formula | C13H8F6N6 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-1-[3-(trifluoromethyl)phenyl]tetrazole |
| SMILES | Cn1cc(-c2nnnn2-c2cccc(C(F)(F)F)c2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H8F6N6/c1-24-6-9(10(21-24)13(17,18)19)11-20-22-23-25(11)8-4-2-3-7(5-8)12(14,15)16/h2-6H,1H3 |
| InChIKey | DQENIRMCVLIYKY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |