C28H34FN7O3 — CID 149073035
N-[(E)-2-[7-[[6-[4-[(2R)-1-hydroxypropan-2-yl]-1,2,4-triazepin-3-yl]-1,2-dihydropyridin-2-yl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-1-enyl]ethanimidoyl fluoride (PubChem CID 149073035) has the molecular formula C28H34FN7O3 and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[(E)-2-[7-[[6-[4-[(2R)-1-hydroxypropan-2-yl]-1,2,4-triazepin-3-yl]-1,2-dihydropyridin-2-yl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-1-enyl]ethanimidoyl fluoride.
| Compound Name | N-[(E)-2-[7-[[6-[4-[(2R)-1-hydroxypropan-2-yl]-1,2,4-triazepin-3-yl]-1,2-dihydropyridin-2-yl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-1-enyl]ethanimidoyl fluoride |
|---|---|
| PubChem CID | 149073035 |
| Molecular Formula | C28H34FN7O3 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-[(E)-2-[7-[[6-[4-[(2R)-1-hydroxypropan-2-yl]-1,2,4-triazepin-3-yl]-1,2-dihydropyridin-2-yl]carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]prop-1-enyl]ethanimidoyl fluoride |
| SMILES | COc1cc2c(cc1C(=O)NC1C=CC=C(C3=NN=CC=CN3[C@H](C)CO)N1)CN(/C(C)=C/N=C(\C)F)CC2 |
| InChI | InChI=1S/C28H34FN7O3/c1-18(15-30-20(3)29)35-12-9-21-14-25(39-4)23(13-22(21)16-35)28(38)33-26-8-5-7-24(32-26)27-34-31-10-6-11-36(27)19(2)17-37/h5-8,10-11,13-15,19,26,32,37H,9,12,16-17H2,1-4H3,(H,33,38)/b18-15+,30-20+/t19-,26?/m1/s1 |
| InChIKey | QOJCDAQXZNFZHK-MFGJYCDPSA-N |
| XLogP | 3.00 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|