C23H32N8O4 — CID 142483794
7-N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-N-ethyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2,7-dicarboxamide (PubChem CID 142483794) has the molecular formula C23H32N8O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 7-N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-N-ethyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2,7-dicarboxamide.
| Compound Name | 7-N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-N-ethyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2,7-dicarboxamide |
|---|---|
| PubChem CID | 142483794 |
| Molecular Formula | C23H32N8O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 7-N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-N-ethyl-6-methoxy-3,4-dihydro-1H-isoquinoline-2,7-dicarboxamide |
| SMILES | CCNC(=O)N1CCc2cc(OC)c(C(=O)Nc3cccc(/C(=N/N)N(N)C(C)CO)n3)cc2C1 |
| InChI | InChI=1S/C23H32N8O4/c1-4-26-23(34)30-9-8-15-11-19(35-3)17(10-16(15)12-30)22(33)28-20-7-5-6-18(27-20)21(29-24)31(25)14(2)13-32/h5-7,10-11,14,32H,4,8-9,12-13,24-25H2,1-3H3,(H,26,34)(H,27,28,33)/b29-21- |
| InChIKey | CGGUPQOMMUUVNZ-ANYBSYGZSA-N |
| XLogP | 0.61 |
| TPSA | 171.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|