C25H32FN7O2 — CID 142483929
N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopentanecarbonyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 142483929) has the molecular formula C25H32FN7O2 and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopentanecarbonyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopentanecarbonyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 142483929 |
| Molecular Formula | C25H32FN7O2 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopentanecarbonyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CC(C)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3c(cc2F)CCN(C(=O)C2CCCC2)C3)n1 |
| InChI | InChI=1S/C25H32FN7O2/c1-15(2)33(28)23(31-27)21-8-5-9-22(29-21)30-24(34)19-12-18-14-32(11-10-17(18)13-20(19)26)25(35)16-6-3-4-7-16/h5,8-9,12-13,15-16H,3-4,6-7,10-11,14,27-28H2,1-2H3,(H,29,30,34)/b31-23- |
| InChIKey | MMVWJGVCOAQJEZ-SXBRIOAWSA-N |
| XLogP | 2.75 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|