C21H29N9OS — CID 142483588
N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide (PubChem CID 142483588) has the molecular formula C21H29N9OS and a molecular weight of 455.59 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 142483588 |
| Molecular Formula | C21H29N9OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
| SMILES | CC(C)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3c(cn2)CN(SN2CCCC2)C3)n1 |
| InChI | InChI=1S/C21H29N9OS/c1-14(2)30(23)20(27-22)17-6-5-7-19(25-17)26-21(31)18-10-15-12-29(13-16(15)11-24-18)32-28-8-3-4-9-28/h5-7,10-11,14H,3-4,8-9,12-13,22-23H2,1-2H3,(H,25,26,31)/b27-20- |
| InChIKey | QUOIYBYOSAYPRZ-OOAXWGSJSA-N |
| XLogP | 1.91 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|