C23H31N9O2 — CID 174349810
N-[6-[(Z)-N-amino-N-[(2R)-1-hydroxypropan-2-yl]carbamohydrazonoyl]-2-pyridinyl]-4-(4-tert-butylimidazol-1-yl)-5-methylpyridine-2-carboxamide (PubChem CID 174349810) has the molecular formula C23H31N9O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-[(2R)-1-hydroxypropan-2-yl]carbamohydrazonoyl]-2-pyridinyl]-4-(4-tert-butylimidazol-1-yl)-5-methylpyridine-2-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-[(2R)-1-hydroxypropan-2-yl]carbamohydrazonoyl]-2-pyridinyl]-4-(4-tert-butylimidazol-1-yl)-5-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 174349810 |
| Molecular Formula | C23H31N9O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-[(2R)-1-hydroxypropan-2-yl]carbamohydrazonoyl]-2-pyridinyl]-4-(4-tert-butylimidazol-1-yl)-5-methylpyridine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2cccc(/C(=N/N)N(N)[C@H](C)CO)n2)cc1-n1cnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H31N9O2/c1-14-10-26-17(9-18(14)31-11-19(27-13-31)23(3,4)5)22(34)29-20-8-6-7-16(28-20)21(30-24)32(25)15(2)12-33/h6-11,13,15,33H,12,24-25H2,1-5H3,(H,28,29,34)/b30-21-/t15-/m1/s1 |
| InChIKey | AYDKNQRROMRGPR-LZUAHWLCSA-N |
| XLogP | 1.70 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|