C23H32N8O3 — CID 142483788
tert-butyl 7-[[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]carbamoyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate (PubChem CID 142483788) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is tert-butyl 7-[[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]carbamoyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate.
| Compound Name | tert-butyl 7-[[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]carbamoyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 142483788 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | tert-butyl 7-[[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]carbamoyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate |
| SMILES | CC(C)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3c(cn2)CCN(C(=O)OC(C)(C)C)C3)n1 |
| InChI | InChI=1S/C23H32N8O3/c1-14(2)31(25)20(29-24)17-7-6-8-19(27-17)28-21(32)18-11-16-13-30(10-9-15(16)12-26-18)22(33)34-23(3,4)5/h6-8,11-12,14H,9-10,13,24-25H2,1-5H3,(H,27,28,32)/b29-20- |
| InChIKey | PQJRCHKWIIATOG-BRPDVVIDSA-N |
| XLogP | 2.23 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|