C22H33N9O3S — CID 142483654
N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide;methanol (PubChem CID 142483654) has the molecular formula C22H33N9O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide;methanol.
| Compound Name | N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide;methanol |
|---|---|
| PubChem CID | 142483654 |
| Molecular Formula | C22H33N9O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-2-pyrrolidin-1-ylsulfanyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide;methanol |
| SMILES | CC(CO)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3c(cn2)CN(SN2CCCC2)C3)n1.CO |
| InChI | InChI=1S/C21H29N9O2S.CH4O/c1-14(13-31)30(23)20(27-22)17-5-4-6-19(25-17)26-21(32)18-9-15-11-29(12-16(15)10-24-18)33-28-7-2-3-8-28;1-2/h4-6,9-10,14,31H,2-3,7-8,11-13,22-23H2,1H3,(H,25,26,32);2H,1H3/b27-20-; |
| InChIKey | JIIFOMWYYLFUCX-HNKVEKQCSA-N |
| XLogP | 0.49 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|