C23H30FN7OS — CID 142483768
N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopropylmethylsulfanyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 142483768) has the molecular formula C23H30FN7OS and a molecular weight of 471.61 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopropylmethylsulfanyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopropylmethylsulfanyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 142483768 |
| Molecular Formula | C23H30FN7OS |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-(cyclopropylmethylsulfanyl)-6-fluoro-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CC(C)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3c(cc2F)CCN(SCC2CC2)C3)n1 |
| InChI | InChI=1S/C23H30FN7OS/c1-14(2)31(26)22(29-25)20-4-3-5-21(27-20)28-23(32)18-10-17-12-30(33-13-15-6-7-15)9-8-16(17)11-19(18)24/h3-5,10-11,14-15H,6-9,12-13,25-26H2,1-2H3,(H,27,28,32)/b29-22- |
| InChIKey | PNPDJPJAXRXFCT-IADYIPOJSA-N |
| XLogP | 3.09 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|