C24H31FN8OS — CID 142483486
N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-[cyclohexyl(methyl)amino]-5-fluoro-1,3-benzothiazole-6-carboxamide (PubChem CID 142483486) has the molecular formula C24H31FN8OS and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-[cyclohexyl(methyl)amino]-5-fluoro-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-[cyclohexyl(methyl)amino]-5-fluoro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 142483486 |
| Molecular Formula | C24H31FN8OS |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-propan-2-ylcarbamohydrazonoyl]-2-pyridinyl]-2-[cyclohexyl(methyl)amino]-5-fluoro-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(C)N(N)/C(=N\N)c1cccc(NC(=O)c2cc3sc(N(C)C4CCCCC4)nc3cc2F)n1 |
| InChI | InChI=1S/C24H31FN8OS/c1-14(2)33(27)22(31-26)18-10-7-11-21(28-18)30-23(34)16-12-20-19(13-17(16)25)29-24(35-20)32(3)15-8-5-4-6-9-15/h7,10-15H,4-6,8-9,26-27H2,1-3H3,(H,28,30,34)/b31-22- |
| InChIKey | QUJCVKMWYZBIKC-VAMRJTSQSA-N |
| XLogP | 4.06 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|