C22H28FN7O4 — CID 142483574
N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-1,3-dihydroisoindole-5-carboxamide (PubChem CID 142483574) has the molecular formula C22H28FN7O4 and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 142483574 |
| Molecular Formula | C22H28FN7O4 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[6-[(Z)-N-amino-N-(1-hydroxypropan-2-yl)carbamohydrazonoyl]-2-pyridinyl]-6-fluoro-2-(3-methoxypropanoyl)-1,3-dihydroisoindole-5-carboxamide |
| SMILES | COCCC(=O)N1Cc2cc(F)c(C(=O)Nc3cccc(/C(=N/N)N(N)C(C)CO)n3)cc2C1 |
| InChI | InChI=1S/C22H28FN7O4/c1-13(12-31)30(25)21(28-24)18-4-3-5-19(26-18)27-22(33)16-8-14-10-29(20(32)6-7-34-2)11-15(14)9-17(16)23/h3-5,8-9,13,31H,6-7,10-12,24-25H2,1-2H3,(H,26,27,33)/b28-21- |
| InChIKey | RCEOFIXQDQAFSX-HFTWOUSFSA-N |
| XLogP | 0.53 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|